C32H26BrN5O3S — CID 126269819
4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-bromo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126269819) has the molecular formula C32H26BrN5O3S and a molecular weight of 640.56 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-bromo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-bromo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126269819 |
| Molecular Formula | C32H26BrN5O3S |
| Molecular Weight | 640.56 g/mol |
| Exact Mass | 639.09 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-bromo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=N/NC(=O)c3ccc(-c4csc(Nc5ccccc5)n4)cc3)cc2Br)cc1 |
| InChI | InChI=1S/C32H26BrN5O3S/c1-21-7-14-26(15-8-21)35-30(39)19-41-29-16-9-22(17-27(29)33)18-34-38-31(40)24-12-10-23(11-13-24)28-20-42-32(37-28)36-25-5-3-2-4-6-25/h2-18,20H,19H2,1H3,(H,35,39)(H,36,37)(H,38,40)/b34-18+ |
| InChIKey | NKHVUIJRAUZXHP-FABQOPTDSA-N |
| XLogP | 7.41 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.56 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|