C34H31N5O4S — CID 126262092
4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]benzamide (PubChem CID 126262092) has the molecular formula C34H31N5O4S and a molecular weight of 605.72 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126262092 |
| Molecular Formula | C34H31N5O4S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)ccc1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C34H31N5O4S/c1-22-9-15-28(23(2)17-22)37-32(40)20-43-30-16-10-24(18-31(30)42-3)19-35-39-33(41)26-13-11-25(12-14-26)29-21-44-34(38-29)36-27-7-5-4-6-8-27/h4-19,21H,20H2,1-3H3,(H,36,38)(H,37,40)(H,39,41)/b35-19+ |
| InChIKey | LWVGCHNQLVYMMW-XZYGTATASA-N |
| XLogP | 6.96 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|