C33H28ClN5O3S — CID 126274299
4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[5-chloro-2-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126274299) has the molecular formula C33H28ClN5O3S and a molecular weight of 610.14 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[5-chloro-2-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[5-chloro-2-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126274299 |
| Molecular Formula | C33H28ClN5O3S |
| Molecular Weight | 610.14 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[5-chloro-2-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(Cl)cc2/C=N/NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C33H28ClN5O3S/c1-21-8-14-28(22(2)16-21)37-31(40)19-42-30-15-13-26(34)17-25(30)18-35-39-32(41)24-11-9-23(10-12-24)29-20-43-33(38-29)36-27-6-4-3-5-7-27/h3-18,20H,19H2,1-2H3,(H,36,38)(H,37,40)(H,39,41)/b35-18+ |
| InChIKey | QFSFGAQOISWFGB-MWBNBJEGSA-N |
| XLogP | 7.61 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.14 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|