C31H24Cl2N4O2S — CID 126036762
4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 126036762) has the molecular formula C31H24Cl2N4O2S and a molecular weight of 587.53 g/mol. Its IUPAC name is 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126036762 |
| Molecular Formula | C31H24Cl2N4O2S |
| Molecular Weight | 587.53 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(COc2ccc(Cl)cc2/C=N\NC(=O)c2ccc(-c3csc(Nc4ccc(Cl)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C31H24Cl2N4O2S/c1-20-2-4-21(5-3-20)18-39-29-15-12-26(33)16-24(29)17-34-37-30(38)23-8-6-22(7-9-23)28-19-40-31(36-28)35-27-13-10-25(32)11-14-27/h2-17,19H,18H2,1H3,(H,35,36)(H,37,38)/b34-17- |
| InChIKey | FKHKXFJLFBPMCI-DLCNMLRHSA-N |
| XLogP | 8.51 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.53 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|