C32H28N4O2S — CID 126038771
4-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-[(Z)-[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 126038771) has the molecular formula C32H28N4O2S and a molecular weight of 532.67 g/mol. Its IUPAC name is 4-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-[(Z)-[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-[(Z)-[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126038771 |
| Molecular Formula | C32H28N4O2S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 4-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-[(Z)-[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(COc2cccc(/C=N\NC(=O)c3ccc(-c4csc(Nc5ccc(C)cc5)n4)cc3)c2)cc1 |
| InChI | InChI=1S/C32H28N4O2S/c1-22-6-10-24(11-7-22)20-38-29-5-3-4-25(18-29)19-33-36-31(37)27-14-12-26(13-15-27)30-21-39-32(35-30)34-28-16-8-23(2)9-17-28/h3-19,21H,20H2,1-2H3,(H,34,35)(H,36,37)/b33-19- |
| InChIKey | ISDGQFYXLWPGIZ-APTWKGOFSA-N |
| XLogP | 7.51 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|