C32H26ClN5O3S — CID 126269354
N-[(E)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126269354) has the molecular formula C32H26ClN5O3S and a molecular weight of 596.11 g/mol. Its IUPAC name is N-[(E)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(E)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126269354 |
| Molecular Formula | C32H26ClN5O3S |
| Molecular Weight | 596.11 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | N-[(E)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | Cc1ccc(Nc2nc(-c3ccc(C(=O)N/N=C/c4cccc(OCC(=O)Nc5ccccc5Cl)c4)cc3)cs2)cc1 |
| InChI | InChI=1S/C32H26ClN5O3S/c1-21-9-15-25(16-10-21)35-32-37-29(20-42-32)23-11-13-24(14-12-23)31(40)38-34-18-22-5-4-6-26(17-22)41-19-30(39)36-28-8-3-2-7-27(28)33/h2-18,20H,19H2,1H3,(H,35,37)(H,36,39)(H,38,40)/b34-18+ |
| InChIKey | AXTFOAWAXCVDDN-FABQOPTDSA-N |
| XLogP | 7.30 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.11 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|