C31H25FN4O2S — CID 126053012
N-[(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126053012) has the molecular formula C31H25FN4O2S and a molecular weight of 536.63 g/mol. Its IUPAC name is N-[(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126053012 |
| Molecular Formula | C31H25FN4O2S |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N-[(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | Cc1ccc(Nc2nc(-c3ccc(C(=O)N/N=C\c4cccc(OCc5ccccc5F)c4)cc3)cs2)cc1 |
| InChI | InChI=1S/C31H25FN4O2S/c1-21-9-15-26(16-10-21)34-31-35-29(20-39-31)23-11-13-24(14-12-23)30(37)36-33-18-22-5-4-7-27(17-22)38-19-25-6-2-3-8-28(25)32/h2-18,20H,19H2,1H3,(H,34,35)(H,36,37)/b33-18- |
| InChIKey | RQTYUGXGLVCABS-OHUYPAJKSA-N |
| XLogP | 7.34 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|