C23H17ClN4O2S — CID 126048114
4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzamide (PubChem CID 126048114) has the molecular formula C23H17ClN4O2S and a molecular weight of 448.94 g/mol. Its IUPAC name is 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126048114 |
| Molecular Formula | C23H17ClN4O2S |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1cccc(O)c1)c1ccc(-c2csc(Nc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C23H17ClN4O2S/c24-18-8-10-19(11-9-18)26-23-27-21(14-31-23)16-4-6-17(7-5-16)22(30)28-25-13-15-2-1-3-20(29)12-15/h1-14,29H,(H,26,27)(H,28,30)/b25-13- |
| InChIKey | JDWFQUIORGTCHD-MXAYSNPKSA-N |
| XLogP | 5.68 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|