C32H25Cl2IN4O3S — CID 126045107
4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]benzamide (PubChem CID 126045107) has the molecular formula C32H25Cl2IN4O3S and a molecular weight of 743.45 g/mol. Its IUPAC name is 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]benzamide.
| Compound Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126045107 |
| Molecular Formula | C32H25Cl2IN4O3S |
| Molecular Weight | 743.45 g/mol |
| Exact Mass | 742.01 |
| IUPAC Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccc(Cl)cc4)n3)cc2)cc(I)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C32H25Cl2IN4O3S/c1-2-41-29-16-21(15-27(35)30(29)42-18-20-4-3-5-25(34)14-20)17-36-39-31(40)23-8-6-22(7-9-23)28-19-43-32(38-28)37-26-12-10-24(33)11-13-26/h3-17,19H,2,18H2,1H3,(H,37,38)(H,39,40)/b36-17- |
| InChIKey | QBVAXZFLFGFAQJ-RODHXAHZSA-N |
| XLogP | 9.21 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.45 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|