C34H30ClN5O4S — CID 126264439
N-[(E)-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126264439) has the molecular formula C34H30ClN5O4S and a molecular weight of 640.17 g/mol. Its IUPAC name is N-[(E)-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(E)-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126264439 |
| Molecular Formula | C34H30ClN5O4S |
| Molecular Weight | 640.17 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | N-[(E)-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccc(C)cc4)n3)cc2)ccc1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H30ClN5O4S/c1-3-43-31-18-23(6-17-30(31)44-20-32(41)37-27-15-11-26(35)12-16-27)19-36-40-33(42)25-9-7-24(8-10-25)29-21-45-34(39-29)38-28-13-4-22(2)5-14-28/h4-19,21H,3,20H2,1-2H3,(H,37,41)(H,38,39)(H,40,42)/b36-19+ |
| InChIKey | SKOLHELSNDHUHU-ODNPBWNPSA-N |
| XLogP | 7.70 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.17 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|