C34H29FIN5O4S — CID 126370707
N-[(E)-[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-iodophenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126370707) has the molecular formula C34H29FIN5O4S and a molecular weight of 749.61 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-iodophenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(E)-[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-iodophenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126370707 |
| Molecular Formula | C34H29FIN5O4S |
| Molecular Weight | 749.61 g/mol |
| Exact Mass | 749.10 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-iodophenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccc(C)cc4)n3)cc2)cc(I)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C34H29FIN5O4S/c1-3-44-30-17-22(16-28(36)32(30)45-19-31(42)38-26-14-10-25(35)11-15-26)18-37-41-33(43)24-8-6-23(7-9-24)29-20-46-34(40-29)39-27-12-4-21(2)5-13-27/h4-18,20H,3,19H2,1-2H3,(H,38,42)(H,39,40)(H,41,43)/b37-18+ |
| InChIKey | XKZFFCBZDOZGEN-RQRWGXNHSA-N |
| XLogP | 7.79 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.61 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|