C35H31BrClN5O4S — CID 126277394
N-[(Z)-[3-bromo-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126277394) has the molecular formula C35H31BrClN5O4S and a molecular weight of 733.09 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(Z)-[3-bromo-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126277394 |
| Molecular Formula | C35H31BrClN5O4S |
| Molecular Weight | 733.09 g/mol |
| Exact Mass | 731.10 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccc(Cl)cc4)n3)cc2)cc(Br)c1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C35H31BrClN5O4S/c1-4-45-31-17-23(16-28(36)33(31)46-19-32(43)40-29-14-5-21(2)15-22(29)3)18-38-42-34(44)25-8-6-24(7-9-25)30-20-47-35(41-30)39-27-12-10-26(37)11-13-27/h5-18,20H,4,19H2,1-3H3,(H,39,41)(H,40,43)(H,42,44)/b38-18- |
| InChIKey | KUBYJERCMWGNNN-FRKGHFGRSA-N |
| XLogP | 8.77 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.09 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|