C32H25Br2N5O3S — CID 126272451
4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3,5-dibromo-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126272451) has the molecular formula C32H25Br2N5O3S and a molecular weight of 719.46 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3,5-dibromo-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3,5-dibromo-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126272451 |
| Molecular Formula | C32H25Br2N5O3S |
| Molecular Weight | 719.46 g/mol |
| Exact Mass | 717.00 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3,5-dibromo-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1cccc(NC(=O)COc2c(Br)cc(/C=N/NC(=O)c3ccc(-c4csc(Nc5ccccc5)n4)cc3)cc2Br)c1 |
| InChI | InChI=1S/C32H25Br2N5O3S/c1-20-6-5-9-25(14-20)36-29(40)18-42-30-26(33)15-21(16-27(30)34)17-35-39-31(41)23-12-10-22(11-13-23)28-19-43-32(38-28)37-24-7-3-2-4-8-24/h2-17,19H,18H2,1H3,(H,36,40)(H,37,38)(H,39,41)/b35-17+ |
| InChIKey | QFPKFTXLVSJCHV-XJECJHNESA-N |
| XLogP | 8.17 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.46 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|