C35H32BrN5O4S — CID 126271645
N-[(E)-[3-bromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126271645) has the molecular formula C35H32BrN5O4S and a molecular weight of 698.64 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(E)-[3-bromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126271645 |
| Molecular Formula | C35H32BrN5O4S |
| Molecular Weight | 698.64 g/mol |
| Exact Mass | 697.14 |
| IUPAC Name | N-[(E)-[3-bromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccc(C)cc4)n3)cc2)cc(Br)c1OCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C35H32BrN5O4S/c1-21-6-13-27(14-7-21)38-35-40-30(20-46-35)25-9-11-26(12-10-25)34(43)41-37-18-24-16-28(36)33(31(17-24)44-4)45-19-32(42)39-29-15-22(2)5-8-23(29)3/h5-18,20H,19H2,1-4H3,(H,38,40)(H,39,42)(H,41,43)/b37-18+ |
| InChIKey | INVWYBGHGABYCU-RQRWGXNHSA-N |
| XLogP | 8.03 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.64 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|