C34H29Cl2N5O4S — CID 126262186
4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[3-chloro-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]benzamide (PubChem CID 126262186) has the molecular formula C34H29Cl2N5O4S and a molecular weight of 674.61 g/mol. Its IUPAC name is 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[3-chloro-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[3-chloro-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126262186 |
| Molecular Formula | C34H29Cl2N5O4S |
| Molecular Weight | 674.61 g/mol |
| Exact Mass | 673.13 |
| IUPAC Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-[3-chloro-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccc(Cl)cc4)n3)cc2)cc(Cl)c1OCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C34H29Cl2N5O4S/c1-20-5-4-6-28(21(20)2)39-31(42)18-45-32-27(36)15-22(16-30(32)44-3)17-37-41-33(43)24-9-7-23(8-10-24)29-19-46-34(40-29)38-26-13-11-25(35)12-14-26/h4-17,19H,18H2,1-3H3,(H,38,40)(H,39,42)(H,41,43)/b37-17- |
| InChIKey | NHFPTGWAJLPQHL-ADJDCTSUSA-N |
| XLogP | 8.27 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.61 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|