C34H30ClN5O5S — CID 126381506
4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-chloro-5-ethoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126381506) has the molecular formula C34H30ClN5O5S and a molecular weight of 656.16 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-chloro-5-ethoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-chloro-5-ethoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126381506 |
| Molecular Formula | C34H30ClN5O5S |
| Molecular Weight | 656.16 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-chloro-5-ethoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)cc(Cl)c1OCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C34H30ClN5O5S/c1-3-44-30-18-22(17-26(35)32(30)45-20-31(41)38-27-11-7-8-12-29(27)43-2)19-36-40-33(42)24-15-13-23(14-16-24)28-21-46-34(39-28)37-25-9-5-4-6-10-25/h4-19,21H,3,20H2,1-2H3,(H,37,39)(H,38,41)(H,40,42)/b36-19+ |
| InChIKey | BXQDSHRSSSCSND-ODNPBWNPSA-N |
| XLogP | 7.40 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.16 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|