C32H27N5O4S — CID 126387113
4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126387113) has the molecular formula C32H27N5O4S and a molecular weight of 577.67 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126387113 |
| Molecular Formula | C32H27N5O4S |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C32H27N5O4S/c1-40-29-10-6-5-9-27(29)35-30(38)20-41-26-17-11-22(12-18-26)19-33-37-31(39)24-15-13-23(14-16-24)28-21-42-32(36-28)34-25-7-3-2-4-8-25/h2-19,21H,20H2,1H3,(H,34,36)(H,35,38)(H,37,39)/b33-19+ |
| InChIKey | OOYVQGWKCBSHDT-HNSNBQBZSA-N |
| XLogP | 6.34 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|