C32H26ClN5O4S — CID 126381921
4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-chloro-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126381921) has the molecular formula C32H26ClN5O4S and a molecular weight of 612.11 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-chloro-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-chloro-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126381921 |
| Molecular Formula | C32H26ClN5O4S |
| Molecular Weight | 612.11 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-chloro-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=N/NC(=O)c3ccc(-c4csc(Nc5ccccc5)n4)cc3)cc2Cl)cc1 |
| InChI | InChI=1S/C32H26ClN5O4S/c1-41-26-14-12-25(13-15-26)35-30(39)19-42-29-16-7-21(17-27(29)33)18-34-38-31(40)23-10-8-22(9-11-23)28-20-43-32(37-28)36-24-5-3-2-4-6-24/h2-18,20H,19H2,1H3,(H,35,39)(H,36,37)(H,38,40)/b34-18+ |
| InChIKey | GNSHFYVXHMYENM-FABQOPTDSA-N |
| XLogP | 7.00 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.11 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|