C34H30ClN5O3S — CID 126262390
N-[(E)-[3-chloro-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126262390) has the molecular formula C34H30ClN5O3S and a molecular weight of 624.17 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(E)-[3-chloro-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126262390 |
| Molecular Formula | C34H30ClN5O3S |
| Molecular Weight | 624.17 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | N-[(E)-[3-chloro-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | Cc1ccc(Nc2nc(-c3ccc(C(=O)N/N=C/c4ccc(OCC(=O)Nc5ccc(C)c(C)c5)c(Cl)c4)cc3)cs2)cc1 |
| InChI | InChI=1S/C34H30ClN5O3S/c1-21-4-12-27(13-5-21)38-34-39-30(20-44-34)25-8-10-26(11-9-25)33(42)40-36-18-24-7-15-31(29(35)17-24)43-19-32(41)37-28-14-6-22(2)23(3)16-28/h4-18,20H,19H2,1-3H3,(H,37,41)(H,38,39)(H,40,42)/b36-18+ |
| InChIKey | KNTGVRUEFRRHFS-IZYHBKOJSA-N |
| XLogP | 7.91 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.17 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|