C30H21Cl3N4O2S — CID 126045296
4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 126045296) has the molecular formula C30H21Cl3N4O2S and a molecular weight of 607.95 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126045296 |
| Molecular Formula | C30H21Cl3N4O2S |
| Molecular Weight | 607.95 g/mol |
| Exact Mass | 606.05 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccc(Cl)cc2Cl)c(Cl)c1)c1ccc(-c2csc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C30H21Cl3N4O2S/c31-23-12-11-22(25(32)15-23)17-39-28-13-6-19(14-26(28)33)16-34-37-29(38)21-9-7-20(8-10-21)27-18-40-30(36-27)35-24-4-2-1-3-5-24/h1-16,18H,17H2,(H,35,36)(H,37,38)/b34-16- |
| InChIKey | FTSQQQCALSEGGG-MJXLXAJKSA-N |
| XLogP | 8.86 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.95 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|