C32H27ClN4O3S — CID 126037963
N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126037963) has the molecular formula C32H27ClN4O3S and a molecular weight of 583.11 g/mol. Its IUPAC name is N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126037963 |
| Molecular Formula | C32H27ClN4O3S |
| Molecular Weight | 583.11 g/mol |
| Exact Mass | 582.15 |
| IUPAC Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccc(C)cc4)n3)cc2)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C32H27ClN4O3S/c1-21-6-13-27(14-7-21)35-32-36-28(20-41-32)24-9-11-25(12-10-24)31(38)37-34-18-22-8-15-29(30(17-22)39-2)40-19-23-4-3-5-26(33)16-23/h3-18,20H,19H2,1-2H3,(H,35,36)(H,37,38)/b34-18- |
| InChIKey | HAWRPCJVAFTCDM-HQDYHJHZSA-N |
| XLogP | 7.87 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.11 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|