C26H23ClN4O3S — CID 137062383
N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 137062383) has the molecular formula C26H23ClN4O3S and a molecular weight of 507.02 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 137062383 |
| Molecular Formula | C26H23ClN4O3S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccc(C)cc4)n3)cc2)cc(Cl)c1O |
| InChI | InChI=1S/C26H23ClN4O3S/c1-3-34-23-13-17(12-21(27)24(23)32)14-28-31-25(33)19-8-6-18(7-9-19)22-15-35-26(30-22)29-20-10-4-16(2)5-11-20/h4-15,32H,3H2,1-2H3,(H,29,30)(H,31,33)/b28-14- |
| InChIKey | ALFZJCVVYUJMSH-MUXKCCDJSA-N |
| XLogP | 6.38 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|