C33H29ClN4O3S — CID 126037440
4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 126037440) has the molecular formula C33H29ClN4O3S and a molecular weight of 597.14 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126037440 |
| Molecular Formula | C33H29ClN4O3S |
| Molecular Weight | 597.14 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)cc(Cl)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C33H29ClN4O3S/c1-3-40-30-18-24(17-28(34)31(30)41-20-23-11-9-22(2)10-12-23)19-35-38-32(39)26-15-13-25(14-16-26)29-21-42-33(37-29)36-27-7-5-4-6-8-27/h4-19,21H,3,20H2,1-2H3,(H,36,37)(H,38,39)/b35-19- |
| InChIKey | FZBJWJZMSCECIZ-KMUKQRDJSA-N |
| XLogP | 8.26 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.14 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|