C35H27ClN4O2S — CID 126038007
N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126038007) has the molecular formula C35H27ClN4O2S and a molecular weight of 603.15 g/mol. Its IUPAC name is N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126038007 |
| Molecular Formula | C35H27ClN4O2S |
| Molecular Weight | 603.15 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | Cc1ccc(Nc2nc(-c3ccc(C(=O)N/N=C\c4c(OCc5ccc(Cl)cc5)ccc5ccccc45)cc3)cs2)cc1 |
| InChI | InChI=1S/C35H27ClN4O2S/c1-23-6-17-29(18-7-23)38-35-39-32(22-43-35)26-10-12-27(13-11-26)34(41)40-37-20-31-30-5-3-2-4-25(30)14-19-33(31)42-21-24-8-15-28(36)16-9-24/h2-20,22H,21H2,1H3,(H,38,39)(H,40,41)/b37-20- |
| InChIKey | HMIDNINGDXCOLS-CLHYIUPASA-N |
| XLogP | 9.01 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.15 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|