C29H24N4O2S — CID 126057160
4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-(2-ethoxynaphthalen-1-yl)methylideneamino]benzamide (PubChem CID 126057160) has the molecular formula C29H24N4O2S and a molecular weight of 492.60 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-(2-ethoxynaphthalen-1-yl)methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-(2-ethoxynaphthalen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126057160 |
| Molecular Formula | C29H24N4O2S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-(2-ethoxynaphthalen-1-yl)methylideneamino]benzamide |
| SMILES | CCOc1ccc2ccccc2c1/C=N\NC(=O)c1ccc(-c2csc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C29H24N4O2S/c1-2-35-27-17-16-20-8-6-7-11-24(20)25(27)18-30-33-28(34)22-14-12-21(13-15-22)26-19-36-29(32-26)31-23-9-4-3-5-10-23/h3-19H,2H2,1H3,(H,31,32)(H,33,34)/b30-18- |
| InChIKey | ZEJREBXIWSLWEQ-YKQZZPSBSA-N |
| XLogP | 6.87 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|