C32H27N5O5S — CID 126038785
4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 126038785) has the molecular formula C32H27N5O5S and a molecular weight of 593.67 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126038785 |
| Molecular Formula | C32H27N5O5S |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H27N5O5S/c1-2-41-30-18-23(10-17-29(30)42-20-22-8-15-27(16-9-22)37(39)40)19-33-36-31(38)25-13-11-24(12-14-25)28-21-43-32(35-28)34-26-6-4-3-5-7-26/h3-19,21H,2,20H2,1H3,(H,34,35)(H,36,38)/b33-19- |
| InChIKey | CVMRRCZLPFKEDE-APTWKGOFSA-N |
| XLogP | 7.20 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|