C32H26BrN5O5S — CID 126043502
4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 126043502) has the molecular formula C32H26BrN5O5S and a molecular weight of 672.56 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126043502 |
| Molecular Formula | C32H26BrN5O5S |
| Molecular Weight | 672.56 g/mol |
| Exact Mass | 671.08 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H26BrN5O5S/c1-2-42-29-17-22(16-27(33)30(29)43-19-21-8-14-26(15-9-21)38(40)41)18-34-37-31(39)24-12-10-23(11-13-24)28-20-44-32(36-28)35-25-6-4-3-5-7-25/h3-18,20H,2,19H2,1H3,(H,35,36)(H,37,39)/b34-18- |
| InChIKey | XJQMKWJZEHVXGD-HQDYHJHZSA-N |
| XLogP | 7.97 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.56 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|