C31H25IN4O3S — CID 126047792
4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide (PubChem CID 126047792) has the molecular formula C31H25IN4O3S and a molecular weight of 660.54 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126047792 |
| Molecular Formula | C31H25IN4O3S |
| Molecular Weight | 660.54 g/mol |
| Exact Mass | 660.07 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C31H25IN4O3S/c1-38-28-17-22(16-26(32)29(28)39-19-21-8-4-2-5-9-21)18-33-36-30(37)24-14-12-23(13-15-24)27-20-40-31(35-27)34-25-10-6-3-7-11-25/h2-18,20H,19H2,1H3,(H,34,35)(H,36,37)/b33-18- |
| InChIKey | VDGMWXOBTNQSAX-OHUYPAJKSA-N |
| XLogP | 7.51 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.54 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|