C34H31N5O5S — CID 126379466
4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126379466) has the molecular formula C34H31N5O5S and a molecular weight of 621.72 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126379466 |
| Molecular Formula | C34H31N5O5S |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(E)-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)ccc1OCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C34H31N5O5S/c1-3-43-31-19-23(9-18-30(31)44-21-32(40)36-27-14-16-28(42-2)17-15-27)20-35-39-33(41)25-12-10-24(11-13-25)29-22-45-34(38-29)37-26-7-5-4-6-8-26/h4-20,22H,3,21H2,1-2H3,(H,36,40)(H,37,38)(H,39,41)/b35-20+ |
| InChIKey | AUTJTUKFDPQTGR-JEPNHJGPSA-N |
| XLogP | 6.74 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|