C30H23FN4O2S — CID 126037463
4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 126037463) has the molecular formula C30H23FN4O2S and a molecular weight of 522.61 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126037463 |
| Molecular Formula | C30H23FN4O2S |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccccc1OCc1ccc(F)cc1)c1ccc(-c2csc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C30H23FN4O2S/c31-25-16-10-21(11-17-25)19-37-28-9-5-4-6-24(28)18-32-35-29(36)23-14-12-22(13-15-23)27-20-38-30(34-27)33-26-7-2-1-3-8-26/h1-18,20H,19H2,(H,33,34)(H,35,36)/b32-18- |
| InChIKey | GAYNPCDCOFVCSP-CAQPMQTCSA-N |
| XLogP | 7.04 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|