C25H18ClFN2O2 — CID 6058956
4-chloro-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 6058956) has the molecular formula C25H18ClFN2O2 and a molecular weight of 432.88 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6058956 |
| Molecular Formula | C25H18ClFN2O2 |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-chloro-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1c(OCc2ccc(F)cc2)ccc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18ClFN2O2/c26-20-10-7-19(8-11-20)25(30)29-28-15-23-22-4-2-1-3-18(22)9-14-24(23)31-16-17-5-12-21(27)13-6-17/h1-15H,16H2,(H,29,30)/b28-15- |
| InChIKey | AJLIEIUKRRAICK-MBTHVWNTSA-N |
| XLogP | 5.98 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|