C31H24FN3O4S — CID 6002265
4-(benzenesulfonamido)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 6002265) has the molecular formula C31H24FN3O4S and a molecular weight of 553.62 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6002265 |
| Molecular Formula | C31H24FN3O4S |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1c(OCc2ccc(F)cc2)ccc2ccccc12)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H24FN3O4S/c32-25-15-10-22(11-16-25)21-39-30-19-14-23-6-4-5-9-28(23)29(30)20-33-34-31(36)24-12-17-26(18-13-24)35-40(37,38)27-7-2-1-3-8-27/h1-20,35H,21H2,(H,34,36)/b33-20- |
| InChIKey | CTRAQGGHGZPFNV-UCMJSZAQSA-N |
| XLogP | 6.12 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|