C33H27N3O5S — CID 3824985
[1-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate (PubChem CID 3824985) has the molecular formula C33H27N3O5S and a molecular weight of 577.66 g/mol. Its IUPAC name is [1-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate.
| Compound Name | [1-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate |
|---|---|
| PubChem CID | 3824985 |
| Molecular Formula | C33H27N3O5S |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | [1-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)NN=Cc3c(OC(=O)c4cccc(C)c4)ccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C33H27N3O5S/c1-22-10-17-28(18-11-22)42(39,40)36-27-15-12-25(13-16-27)32(37)35-34-21-30-29-9-4-3-7-24(29)14-19-31(30)41-33(38)26-8-5-6-23(2)20-26/h3-21,36H,1-2H3,(H,35,37) |
| InChIKey | MEMWACLOQJWXMT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|