C25H18N2O3 — CID 3442368
[1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] benzoate (PubChem CID 3442368) has the molecular formula C25H18N2O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 3442368 |
| Molecular Formula | C25H18N2O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] benzoate |
| SMILES | O=C(NN=Cc1c(OC(=O)c2ccccc2)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H18N2O3/c28-24(19-10-3-1-4-11-19)27-26-17-22-21-14-8-7-9-18(21)15-16-23(22)30-25(29)20-12-5-2-6-13-20/h1-17H,(H,27,28) |
| InChIKey | MDQRCAWGSZJNMK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|