C24H17N3O3 — CID 6002854
[1-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]naphthalen-2-yl] benzoate (PubChem CID 6002854) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is [1-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 6002854 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [1-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]naphthalen-2-yl] benzoate |
| SMILES | O=C(N/N=C\c1c(OC(=O)c2ccccc2)ccc2ccccc12)c1cccnc1 |
| InChI | InChI=1S/C24H17N3O3/c28-23(19-10-6-14-25-15-19)27-26-16-21-20-11-5-4-7-17(20)12-13-22(21)30-24(29)18-8-2-1-3-9-18/h1-16H,(H,27,28)/b26-16- |
| InChIKey | YCYZUKRVYAKRCC-QQXSKIMKSA-N |
| XLogP | 4.22 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|