C26H21N3O5S — CID 6157269
[1-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate (PubChem CID 6157269) has the molecular formula C26H21N3O5S and a molecular weight of 487.54 g/mol. Its IUPAC name is [1-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 6157269 |
| Molecular Formula | C26H21N3O5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | [1-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)N/N=C\c1c(OC(=O)c2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C26H21N3O5S/c30-25(18-28-35(32,33)21-12-5-2-6-13-21)29-27-17-23-22-14-8-7-9-19(22)15-16-24(23)34-26(31)20-10-3-1-4-11-20/h1-17,28H,18H2,(H,29,30)/b27-17- |
| InChIKey | WPAKDQCHDQONLX-PKAZHMFMSA-N |
| XLogP | 3.49 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|