C27H20IN3O4 — CID 51061339
[1-[(E)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate (PubChem CID 51061339) has the molecular formula C27H20IN3O4 and a molecular weight of 577.38 g/mol. Its IUPAC name is [1-[(E)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[(E)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 51061339 |
| Molecular Formula | C27H20IN3O4 |
| Molecular Weight | 577.38 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | [1-[(E)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
| SMILES | O=C(CNC(=O)c1ccccc1I)N/N=C/c1c(OC(=O)c2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C27H20IN3O4/c28-23-13-7-6-12-21(23)26(33)29-17-25(32)31-30-16-22-20-11-5-4-8-18(20)14-15-24(22)35-27(34)19-9-2-1-3-10-19/h1-16H,17H2,(H,29,33)(H,31,32)/b30-16+ |
| InChIKey | CKGFJBCYZLGNAL-OKCVXOCRSA-N |
| XLogP | 4.54 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|