C26H19IN2O4 — CID 6017514
[1-[(Z)-[(2-iodobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate (PubChem CID 6017514) has the molecular formula C26H19IN2O4 and a molecular weight of 550.35 g/mol. Its IUPAC name is [1-[(Z)-[(2-iodobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate.
| Compound Name | [1-[(Z)-[(2-iodobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 6017514 |
| Molecular Formula | C26H19IN2O4 |
| Molecular Weight | 550.35 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | [1-[(Z)-[(2-iodobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3ccccc3c2/C=N\NC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C26H19IN2O4/c1-32-19-13-10-18(11-14-19)26(31)33-24-15-12-17-6-2-3-7-20(17)22(24)16-28-29-25(30)21-8-4-5-9-23(21)27/h2-16H,1H3,(H,29,30)/b28-16- |
| InChIKey | XKKPZAVMHQOYSP-NTFVMDSBSA-N |
| XLogP | 5.44 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.35 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|