C27H22N2O4 — CID 3871773
[1-[[(4-methylbenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate (PubChem CID 3871773) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is [1-[[(4-methylbenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate.
| Compound Name | [1-[[(4-methylbenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3871773 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [1-[[(4-methylbenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3ccccc3c2C=NNC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H22N2O4/c1-18-7-9-20(10-8-18)26(30)29-28-17-24-23-6-4-3-5-19(23)13-16-25(24)33-27(31)21-11-14-22(32-2)15-12-21/h3-17H,1-2H3,(H,29,30) |
| InChIKey | ADUHOQJQRQAXGF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|