C26H20FN3O3S — CID 6274028
[1-[(Z)-[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate (PubChem CID 6274028) has the molecular formula C26H20FN3O3S and a molecular weight of 473.53 g/mol. Its IUPAC name is [1-[(Z)-[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate.
| Compound Name | [1-[(Z)-[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 6274028 |
| Molecular Formula | C26H20FN3O3S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | [1-[(Z)-[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3ccccc3c2/C=N\NC(=S)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H20FN3O3S/c1-32-21-13-6-18(7-14-21)25(31)33-24-15-8-17-4-2-3-5-22(17)23(24)16-28-30-26(34)29-20-11-9-19(27)10-12-20/h2-16H,1H3,(H2,29,30,34)/b28-16- |
| InChIKey | USFRWSHPNQRXES-NTFVMDSBSA-N |
| XLogP | 5.53 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|