C28H23N3O5 — CID 4549106
[1-[[[2-(2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methylbenzoate (PubChem CID 4549106) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is [1-[[[2-(2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methylbenzoate.
| Compound Name | [1-[[[2-(2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 4549106 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [1-[[[2-(2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methylbenzoate |
| SMILES | COc1ccccc1NC(=O)C(=O)NN=Cc1c(OC(=O)c2ccc(C)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C28H23N3O5/c1-18-11-13-20(14-12-18)28(34)36-24-16-15-19-7-3-4-8-21(19)22(24)17-29-31-27(33)26(32)30-23-9-5-6-10-25(23)35-2/h3-17H,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | AMXLBQSMMPQQQG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|