C34H26N4O5 — CID 4143512
[1-[[[2-[2-[(4-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate (PubChem CID 4143512) has the molecular formula C34H26N4O5 and a molecular weight of 570.61 g/mol. Its IUPAC name is [1-[[[2-[2-[(4-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[[[2-[2-[(4-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 4143512 |
| Molecular Formula | C34H26N4O5 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | [1-[[[2-[2-[(4-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)C(=O)NN=Cc2c(OC(=O)c3ccccc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C34H26N4O5/c1-22-15-18-25(19-16-22)36-31(39)27-13-7-8-14-29(27)37-32(40)33(41)38-35-21-28-26-12-6-5-9-23(26)17-20-30(28)43-34(42)24-10-3-2-4-11-24/h2-21H,1H3,(H,36,39)(H,37,40)(H,38,41) |
| InChIKey | JEWGWKSJNMXVKH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|