C30H35N3O4 — CID 4077342
[1-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate (PubChem CID 4077342) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is [1-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 4077342 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | [1-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1c(OC(=O)c2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C30H35N3O4/c1-2-3-4-5-6-7-11-18-28(34)31-22-29(35)33-32-21-26-25-17-13-12-14-23(25)19-20-27(26)37-30(36)24-15-9-8-10-16-24/h8-10,12-17,19-21H,2-7,11,18,22H2,1H3,(H,31,34)(H,33,35) |
| InChIKey | SPUAPIRMZDCQAJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|