C27H33N3O2 — CID 4142604
N-[2-[2-(anthracen-9-ylmethylidene)hydrazinyl]-2-oxoethyl]decanamide (PubChem CID 4142604) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[2-[2-(anthracen-9-ylmethylidene)hydrazinyl]-2-oxoethyl]decanamide.
| Compound Name | N-[2-[2-(anthracen-9-ylmethylidene)hydrazinyl]-2-oxoethyl]decanamide |
|---|---|
| PubChem CID | 4142604 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N-[2-[2-(anthracen-9-ylmethylidene)hydrazinyl]-2-oxoethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C27H33N3O2/c1-2-3-4-5-6-7-8-17-26(31)28-20-27(32)30-29-19-25-23-15-11-9-13-21(23)18-22-14-10-12-16-24(22)25/h9-16,18-19H,2-8,17,20H2,1H3,(H,28,31)(H,30,32) |
| InChIKey | YGDMZSGNMBWQQG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|