C30H36FN3O3 — CID 5077393
N-[2-[2-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]hydrazinyl]-2-oxoethyl]decanamide (PubChem CID 5077393) has the molecular formula C30H36FN3O3 and a molecular weight of 505.63 g/mol. Its IUPAC name is N-[2-[2-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]hydrazinyl]-2-oxoethyl]decanamide.
| Compound Name | N-[2-[2-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]hydrazinyl]-2-oxoethyl]decanamide |
|---|---|
| PubChem CID | 5077393 |
| Molecular Formula | C30H36FN3O3 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | N-[2-[2-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]hydrazinyl]-2-oxoethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1c(OCc2ccc(F)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C30H36FN3O3/c1-2-3-4-5-6-7-8-13-29(35)32-21-30(36)34-33-20-27-26-12-10-9-11-24(26)16-19-28(27)37-22-23-14-17-25(31)18-15-23/h9-12,14-20H,2-8,13,21-22H2,1H3,(H,32,35)(H,34,36) |
| InChIKey | BXNZBMSVTBFATK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|