C30H36N2O4 — CID 6026070
[1-[(Z)-(decanoylhydrazinylidene)methyl]naphthalen-2-yl] 4-ethoxybenzoate (PubChem CID 6026070) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is [1-[(Z)-(decanoylhydrazinylidene)methyl]naphthalen-2-yl] 4-ethoxybenzoate.
| Compound Name | [1-[(Z)-(decanoylhydrazinylidene)methyl]naphthalen-2-yl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 6026070 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | [1-[(Z)-(decanoylhydrazinylidene)methyl]naphthalen-2-yl] 4-ethoxybenzoate |
| SMILES | CCCCCCCCCC(=O)N/N=C\c1c(OC(=O)c2ccc(OCC)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C30H36N2O4/c1-3-5-6-7-8-9-10-15-29(33)32-31-22-27-26-14-12-11-13-23(26)18-21-28(27)36-30(34)24-16-19-25(20-17-24)35-4-2/h11-14,16-22H,3-10,15H2,1-2H3,(H,32,33)/b31-22- |
| InChIKey | ZXPCNMBMAHRIOO-VAMRJTSQSA-N |
| XLogP | 7.05 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|