C28H24N2O4 — CID 3794929
[1-[[(2-phenylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-ethoxybenzoate (PubChem CID 3794929) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is [1-[[(2-phenylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-ethoxybenzoate.
| Compound Name | [1-[[(2-phenylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 3794929 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [1-[[(2-phenylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc3ccccc3c2C=NNC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2O4/c1-2-33-23-15-12-22(13-16-23)28(32)34-26-17-14-21-10-6-7-11-24(21)25(26)19-29-30-27(31)18-20-8-4-3-5-9-20/h3-17,19H,2,18H2,1H3,(H,30,31) |
| InChIKey | TUNHRMNGYONVCA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|