C26H22N2O4S — CID 6264639
[1-[(Z)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]naphthalen-2-yl] 4-methylbenzoate (PubChem CID 6264639) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is [1-[(Z)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]naphthalen-2-yl] 4-methylbenzoate.
| Compound Name | [1-[(Z)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]naphthalen-2-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 6264639 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [1-[(Z)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]naphthalen-2-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc3ccccc3c2/C=N\NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H22N2O4S/c1-18-7-11-21(12-8-18)26(29)32-25-16-13-20-5-3-4-6-23(20)24(25)17-27-28-33(30,31)22-14-9-19(2)10-15-22/h3-17,28H,1-2H3/b27-17- |
| InChIKey | GIKNVXQFJQMFEF-PKAZHMFMSA-N |
| XLogP | 4.99 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|