C25H19ClN2O4S — CID 6112739
[1-[(Z)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate (PubChem CID 6112739) has the molecular formula C25H19ClN2O4S and a molecular weight of 478.96 g/mol. Its IUPAC name is [1-[(Z)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate.
| Compound Name | [1-[(Z)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6112739 |
| Molecular Formula | C25H19ClN2O4S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | [1-[(Z)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C\c2c(OC(=O)c3ccccc3Cl)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H19ClN2O4S/c1-17-10-13-19(14-11-17)33(30,31)28-27-16-22-20-7-3-2-6-18(20)12-15-24(22)32-25(29)21-8-4-5-9-23(21)26/h2-16,28H,1H3/b27-16- |
| InChIKey | SCZLFJACULDUSI-YUMHPJSZSA-N |
| XLogP | 5.33 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|