C21H17ClN2O5S — CID 6908577
[4-[(E)-(benzenesulfonylhydrazinylidene)methyl]-2-methoxyphenyl] 2-chlorobenzoate (PubChem CID 6908577) has the molecular formula C21H17ClN2O5S and a molecular weight of 444.90 g/mol. Its IUPAC name is [4-[(E)-(benzenesulfonylhydrazinylidene)methyl]-2-methoxyphenyl] 2-chlorobenzoate.
| Compound Name | [4-[(E)-(benzenesulfonylhydrazinylidene)methyl]-2-methoxyphenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6908577 |
| Molecular Formula | C21H17ClN2O5S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | [4-[(E)-(benzenesulfonylhydrazinylidene)methyl]-2-methoxyphenyl] 2-chlorobenzoate |
| SMILES | COc1cc(/C=N/NS(=O)(=O)c2ccccc2)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H17ClN2O5S/c1-28-20-13-15(14-23-24-30(26,27)16-7-3-2-4-8-16)11-12-19(20)29-21(25)17-9-5-6-10-18(17)22/h2-14,24H,1H3/b23-14+ |
| InChIKey | AWGKVMIUWFNXED-OEAKJJBVSA-N |
| XLogP | 3.88 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|